C15H23FN2 — CID 55085371
N-cyclohexyl-N'-(3-fluorophenyl)-N'-methylethane-1,2-diamine (PubChem CID 55085371) has the molecular formula C15H23FN2 and a molecular weight of 250.36 g/mol. Its IUPAC name is N-cyclohexyl-N'-(3-fluorophenyl)-N'-methylethane-1,2-diamine.
| Compound Name | N-cyclohexyl-N'-(3-fluorophenyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 55085371 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | N-cyclohexyl-N'-(3-fluorophenyl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNC1CCCCC1)c1cccc(F)c1 |
| InChI | InChI=1S/C15H23FN2/c1-18(15-9-5-6-13(16)12-15)11-10-17-14-7-3-2-4-8-14/h5-6,9,12,14,17H,2-4,7-8,10-11H2,1H3 |
| InChIKey | YJDMLLLQDGQEJF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |