About N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine
N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine (PubChem CID 62575307) has the molecular formula C16H25FN2
and a molecular weight of 264.39 g/mol. Its IUPAC name is N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine |
| PubChem CID | 62575307 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine |
| SMILES | CCN(CCNC1CCCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H25FN2/c1-2-19(16-10-8-14(17)9-11-16)13-12-18-15-6-4-3-5-7-15/h8-11,15,18H,2-7,12-13H2,1H3 |
| InChIKey | SSLCSIOSUPSGDB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine?
The IUPAC name of N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine (CID 62575307) is N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine.
What is the SMILES notation for N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine?
The canonical SMILES for N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine is CCN(CCNC1CCCCC1)c1ccc(F)cc1.
What is the InChIKey of N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine?
The InChIKey is SSLCSIOSUPSGDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25FN2/c1-2-19(16-10-8-14(17)9-11-16)13-12-18-15-6-4-3-5-7-15/h8-11,15,18H,2-7,12-13H2,1H3.
What are the key properties of N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine?
N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine has a molecular weight of 264.39 g/mol, XLogP of 3.57, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N'-ethyl-N'-(4-fluorophenyl)ethane-1,2-diamine is sourced from PubChem (CID 62575307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).