C12H17FN2 — CID 116679881
N-[2-(azetidin-3-yl)ethyl]-3-fluoro-N-methylaniline (PubChem CID 116679881) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is N-[2-(azetidin-3-yl)ethyl]-3-fluoro-N-methylaniline.
| Compound Name | N-[2-(azetidin-3-yl)ethyl]-3-fluoro-N-methylaniline |
|---|---|
| PubChem CID | 116679881 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | N-[2-(azetidin-3-yl)ethyl]-3-fluoro-N-methylaniline |
| SMILES | CN(CCC1CNC1)c1cccc(F)c1 |
| InChI | InChI=1S/C12H17FN2/c1-15(6-5-10-8-14-9-10)12-4-2-3-11(13)7-12/h2-4,7,10,14H,5-6,8-9H2,1H3 |
| InChIKey | YUETZNJMLAYJQB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |