C21H18N4O5 — CID 6246276
(4Z)-2-(4-nitrophenyl)-4-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methylidene]-1,3-oxazol-5-one (PubChem CID 6246276) has the molecular formula C21H18N4O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is (4Z)-2-(4-nitrophenyl)-4-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(4-nitrophenyl)-4-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6246276 |
| Molecular Formula | C21H18N4O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (4Z)-2-(4-nitrophenyl)-4-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc([N+](=O)[O-])cc2)=N/C1=C\N1CC2CC(C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C21H18N4O5/c26-19-3-1-2-18-15-8-13(10-24(18)19)9-23(11-15)12-17-21(27)30-20(22-17)14-4-6-16(7-5-14)25(28)29/h1-7,12-13,15H,8-11H2/b17-12- |
| InChIKey | FACKTZFIIFHBED-ATVHPVEESA-N |
| XLogP | 2.02 |
| TPSA | 107.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|