C16H16N4O — CID 62464027
3-[[2-(ethylamino)-4-pyridinyl]methyl]quinazolin-4-one (PubChem CID 62464027) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-[[2-(ethylamino)-4-pyridinyl]methyl]quinazolin-4-one.
| Compound Name | 3-[[2-(ethylamino)-4-pyridinyl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 62464027 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3-[[2-(ethylamino)-4-pyridinyl]methyl]quinazolin-4-one |
| SMILES | CCNc1cc(Cn2cnc3ccccc3c2=O)ccn1 |
| InChI | InChI=1S/C16H16N4O/c1-2-17-15-9-12(7-8-18-15)10-20-11-19-14-6-4-3-5-13(14)16(20)21/h3-9,11H,2,10H2,1H3,(H,17,18) |
| InChIKey | UPWOOOAUECPVGD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |