C18H29NO2 — CID 62466933
3-[1-[3-(2,5-dimethylphenoxy)propyl]pyrrolidin-2-yl]propan-1-ol (PubChem CID 62466933) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 3-[1-[3-(2,5-dimethylphenoxy)propyl]pyrrolidin-2-yl]propan-1-ol.
| Compound Name | 3-[1-[3-(2,5-dimethylphenoxy)propyl]pyrrolidin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 62466933 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 3-[1-[3-(2,5-dimethylphenoxy)propyl]pyrrolidin-2-yl]propan-1-ol |
| SMILES | Cc1ccc(C)c(OCCCN2CCCC2CCCO)c1 |
| InChI | InChI=1S/C18H29NO2/c1-15-8-9-16(2)18(14-15)21-13-5-11-19-10-3-6-17(19)7-4-12-20/h8-9,14,17,20H,3-7,10-13H2,1-2H3 |
| InChIKey | GQBCVPZXEPYHFF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|