C16H26N2O2 — CID 62466981
3-[1-[3-(2-aminophenoxy)propyl]pyrrolidin-2-yl]propan-1-ol (PubChem CID 62466981) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 3-[1-[3-(2-aminophenoxy)propyl]pyrrolidin-2-yl]propan-1-ol.
| Compound Name | 3-[1-[3-(2-aminophenoxy)propyl]pyrrolidin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 62466981 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 3-[1-[3-(2-aminophenoxy)propyl]pyrrolidin-2-yl]propan-1-ol |
| SMILES | Nc1ccccc1OCCCN1CCCC1CCCO |
| InChI | InChI=1S/C16H26N2O2/c17-15-8-1-2-9-16(15)20-13-5-11-18-10-3-6-14(18)7-4-12-19/h1-2,8-9,14,19H,3-7,10-13,17H2 |
| InChIKey | JRALEFMUCMXLFN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|