C16H27N3 — CID 62469641
4-[(3,5-dimethylpiperidin-1-yl)methyl]-N-propylpyridin-2-amine (PubChem CID 62469641) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 4-[(3,5-dimethylpiperidin-1-yl)methyl]-N-propylpyridin-2-amine.
| Compound Name | 4-[(3,5-dimethylpiperidin-1-yl)methyl]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 62469641 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 4-[(3,5-dimethylpiperidin-1-yl)methyl]-N-propylpyridin-2-amine |
| SMILES | CCCNc1cc(CN2CC(C)CC(C)C2)ccn1 |
| InChI | InChI=1S/C16H27N3/c1-4-6-17-16-9-15(5-7-18-16)12-19-10-13(2)8-14(3)11-19/h5,7,9,13-14H,4,6,8,10-12H2,1-3H3,(H,17,18) |
| InChIKey | NXFWIJCRMNUUBH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |