C15H24N4O — CID 62471287
1-[[2-(propylamino)-4-pyridinyl]methyl]piperidine-3-carboxamide (PubChem CID 62471287) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-[[2-(propylamino)-4-pyridinyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-[[2-(propylamino)-4-pyridinyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 62471287 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 1-[[2-(propylamino)-4-pyridinyl]methyl]piperidine-3-carboxamide |
| SMILES | CCCNc1cc(CN2CCCC(C(N)=O)C2)ccn1 |
| InChI | InChI=1S/C15H24N4O/c1-2-6-17-14-9-12(5-7-18-14)10-19-8-3-4-13(11-19)15(16)20/h5,7,9,13H,2-4,6,8,10-11H2,1H3,(H2,16,20)(H,17,18) |
| InChIKey | HLLBLRVLQXYEDI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |