C15H16ClNO — CID 62471218
2-chloro-3-[(2,3,5-trimethylphenoxy)methyl]pyridine (PubChem CID 62471218) has the molecular formula C15H16ClNO and a molecular weight of 261.75 g/mol. Its IUPAC name is 2-chloro-3-[(2,3,5-trimethylphenoxy)methyl]pyridine.
| Compound Name | 2-chloro-3-[(2,3,5-trimethylphenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 62471218 |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-chloro-3-[(2,3,5-trimethylphenoxy)methyl]pyridine |
| SMILES | Cc1cc(C)c(C)c(OCc2cccnc2Cl)c1 |
| InChI | InChI=1S/C15H16ClNO/c1-10-7-11(2)12(3)14(8-10)18-9-13-5-4-6-17-15(13)16/h4-8H,9H2,1-3H3 |
| InChIKey | NCBJJQYWZMIZDC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|