C15H18N4 — CID 62471385
[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-2-pyridinyl]hydrazine (PubChem CID 62471385) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is [4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-2-pyridinyl]hydrazine.
| Compound Name | [4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62471385 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1cc(CN2CCc3ccccc3C2)ccn1 |
| InChI | InChI=1S/C15H18N4/c16-18-15-9-12(5-7-17-15)10-19-8-6-13-3-1-2-4-14(13)11-19/h1-5,7,9H,6,8,10-11,16H2,(H,17,18) |
| InChIKey | USTRQNHDDPELKE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|