C13H25N3O5 — CID 62475235
2-[[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]carbamoyl]amino]-4-methoxybutanoic acid (PubChem CID 62475235) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]carbamoyl]amino]-4-methoxybutanoic acid.
| Compound Name | 2-[[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]carbamoyl]amino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 62475235 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-[[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]carbamoyl]amino]-4-methoxybutanoic acid |
| SMILES | CCN(CC(=O)NC(C)C)C(=O)NC(CCOC)C(=O)O |
| InChI | InChI=1S/C13H25N3O5/c1-5-16(8-11(17)14-9(2)3)13(20)15-10(12(18)19)6-7-21-4/h9-10H,5-8H2,1-4H3,(H,14,17)(H,15,20)(H,18,19) |
| InChIKey | CHAGMAICSNRUBX-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |