C13H24N2O6 — CID 62475240
2-[[(2-ethoxy-2-oxoethyl)-propan-2-ylcarbamoyl]amino]-4-methoxybutanoic acid (PubChem CID 62475240) has the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. Its IUPAC name is 2-[[(2-ethoxy-2-oxoethyl)-propan-2-ylcarbamoyl]amino]-4-methoxybutanoic acid.
| Compound Name | 2-[[(2-ethoxy-2-oxoethyl)-propan-2-ylcarbamoyl]amino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 62475240 |
| Molecular Formula | C13H24N2O6 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-[[(2-ethoxy-2-oxoethyl)-propan-2-ylcarbamoyl]amino]-4-methoxybutanoic acid |
| SMILES | CCOC(=O)CN(C(=O)NC(CCOC)C(=O)O)C(C)C |
| InChI | InChI=1S/C13H24N2O6/c1-5-21-11(16)8-15(9(2)3)13(19)14-10(12(17)18)6-7-20-4/h9-10H,5-8H2,1-4H3,(H,14,19)(H,17,18) |
| InChIKey | CSAFKVUYRJWPBV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |