C17H23N3O — CID 62475319
N-benzyl-2-[(1,2,5-trimethylpyrrol-3-yl)methylamino]acetamide (PubChem CID 62475319) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is N-benzyl-2-[(1,2,5-trimethylpyrrol-3-yl)methylamino]acetamide.
| Compound Name | N-benzyl-2-[(1,2,5-trimethylpyrrol-3-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 62475319 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-benzyl-2-[(1,2,5-trimethylpyrrol-3-yl)methylamino]acetamide |
| SMILES | Cc1cc(CNCC(=O)NCc2ccccc2)c(C)n1C |
| InChI | InChI=1S/C17H23N3O/c1-13-9-16(14(2)20(13)3)11-18-12-17(21)19-10-15-7-5-4-6-8-15/h4-9,18H,10-12H2,1-3H3,(H,19,21) |
| InChIKey | PGQAWFXUNNLNLR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |