About 4-ethoxy-N'-hydroxypiperidine-1-carboximidamide
4-ethoxy-N'-hydroxypiperidine-1-carboximidamide (PubChem CID 62481285) has the molecular formula C8H17N3O2
and a molecular weight of 187.24 g/mol. Its IUPAC name is 4-ethoxy-N'-hydroxypiperidine-1-carboximidamide.
Molecular Properties
| Compound Name | 4-ethoxy-N'-hydroxypiperidine-1-carboximidamide |
| PubChem CID | 62481285 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 4-ethoxy-N'-hydroxypiperidine-1-carboximidamide |
| SMILES | CCOC1CCN(/C(N)=N/O)CC1 |
| InChI | InChI=1S/C8H17N3O2/c1-2-13-7-3-5-11(6-4-7)8(9)10-12/h7,12H,2-6H2,1H3,(H2,9,10) |
| InChIKey | HRFIZDJMGMJBSV-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-N'-hydroxypiperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-N'-hydroxypiperidine-1-carboximidamide?
The IUPAC name of 4-ethoxy-N'-hydroxypiperidine-1-carboximidamide (CID 62481285) is 4-ethoxy-N'-hydroxypiperidine-1-carboximidamide.
What is the SMILES notation for 4-ethoxy-N'-hydroxypiperidine-1-carboximidamide?
The canonical SMILES for 4-ethoxy-N'-hydroxypiperidine-1-carboximidamide is CCOC1CCN(/C(N)=N/O)CC1.
What is the InChIKey of 4-ethoxy-N'-hydroxypiperidine-1-carboximidamide?
The InChIKey is HRFIZDJMGMJBSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O2/c1-2-13-7-3-5-11(6-4-7)8(9)10-12/h7,12H,2-6H2,1H3,(H2,9,10).
What are the key properties of 4-ethoxy-N'-hydroxypiperidine-1-carboximidamide?
4-ethoxy-N'-hydroxypiperidine-1-carboximidamide has a molecular weight of 187.24 g/mol, XLogP of 0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-N'-hydroxypiperidine-1-carboximidamide is sourced from PubChem (CID 62481285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).