C12H26IN3O — CID 111958958
4-ethoxy-N'-ethyl-N,N-dimethylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111958958) has the molecular formula C12H26IN3O and a molecular weight of 355.26 g/mol. Its IUPAC name is 4-ethoxy-N'-ethyl-N,N-dimethylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N'-ethyl-N,N-dimethylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111958958 |
| Molecular Formula | C12H26IN3O |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-ethoxy-N'-ethyl-N,N-dimethylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CC/N=C(\N(C)C)N1CCC(OCC)CC1.I |
| InChI | InChI=1S/C12H25N3O.HI/c1-5-13-12(14(3)4)15-9-7-11(8-10-15)16-6-2;/h11H,5-10H2,1-4H3;1H/b13-12+; |
| InChIKey | PKGXBEAWJQQNTG-UEIGIMKUSA-N |
| XLogP | 2.04 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|