C6H16N4O — CID 62483535
2-[2-(dimethylamino)propyl]-1-hydroxyguanidine (PubChem CID 62483535) has the molecular formula C6H16N4O and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-[2-(dimethylamino)propyl]-1-hydroxyguanidine.
| Compound Name | 2-[2-(dimethylamino)propyl]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 62483535 |
| Molecular Formula | C6H16N4O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 2-[2-(dimethylamino)propyl]-1-hydroxyguanidine |
| SMILES | CC(C/N=C(\N)NO)N(C)C |
| InChI | InChI=1S/C6H16N4O/c1-5(10(2)3)4-8-6(7)9-11/h5,11H,4H2,1-3H3,(H3,7,8,9) |
| InChIKey | KUOCXKULWGQSCS-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|