C6H12N4 — CID 62483589
2-ethyl-4-methylimidazole-1,5-diamine (PubChem CID 62483589) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-ethyl-4-methylimidazole-1,5-diamine.
| Compound Name | 2-ethyl-4-methylimidazole-1,5-diamine |
|---|---|
| PubChem CID | 62483589 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 2-ethyl-4-methylimidazole-1,5-diamine |
| SMILES | CCc1nc(C)c(N)n1N |
| InChI | InChI=1S/C6H12N4/c1-3-5-9-4(2)6(7)10(5)8/h3,7-8H2,1-2H3 |
| InChIKey | ZNYGOZKZTURRAC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |