C16H20ClNO — CID 62484155
2-(4-chloronaphthalen-1-yl)oxy-N,3-dimethylbutan-1-amine (PubChem CID 62484155) has the molecular formula C16H20ClNO and a molecular weight of 277.79 g/mol. Its IUPAC name is 2-(4-chloronaphthalen-1-yl)oxy-N,3-dimethylbutan-1-amine.
| Compound Name | 2-(4-chloronaphthalen-1-yl)oxy-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 62484155 |
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.79 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-(4-chloronaphthalen-1-yl)oxy-N,3-dimethylbutan-1-amine |
| SMILES | CNCC(Oc1ccc(Cl)c2ccccc12)C(C)C |
| InChI | InChI=1S/C16H20ClNO/c1-11(2)16(10-18-3)19-15-9-8-14(17)12-6-4-5-7-13(12)15/h4-9,11,16,18H,10H2,1-3H3 |
| InChIKey | LMHYHSZQWYGZJH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |