C18H24N2O — CID 62484882
3-[[2-(ethylaminomethyl)phenyl]methoxy]-N,N-dimethylaniline (PubChem CID 62484882) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 3-[[2-(ethylaminomethyl)phenyl]methoxy]-N,N-dimethylaniline.
| Compound Name | 3-[[2-(ethylaminomethyl)phenyl]methoxy]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 62484882 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 3-[[2-(ethylaminomethyl)phenyl]methoxy]-N,N-dimethylaniline |
| SMILES | CCNCc1ccccc1COc1cccc(N(C)C)c1 |
| InChI | InChI=1S/C18H24N2O/c1-4-19-13-15-8-5-6-9-16(15)14-21-18-11-7-10-17(12-18)20(2)3/h5-12,19H,4,13-14H2,1-3H3 |
| InChIKey | LGTIWDNLPTVLAO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |