C15H17BrClNO2 — CID 62485295
N-[[3-[(4-bromo-2-chlorophenoxy)methyl]furan-2-yl]methyl]propan-2-amine (PubChem CID 62485295) has the molecular formula C15H17BrClNO2 and a molecular weight of 358.66 g/mol. Its IUPAC name is N-[[3-[(4-bromo-2-chlorophenoxy)methyl]furan-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[3-[(4-bromo-2-chlorophenoxy)methyl]furan-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 62485295 |
| Molecular Formula | C15H17BrClNO2 |
| Molecular Weight | 358.66 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | N-[[3-[(4-bromo-2-chlorophenoxy)methyl]furan-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1occc1COc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H17BrClNO2/c1-10(2)18-8-15-11(5-6-19-15)9-20-14-4-3-12(16)7-13(14)17/h3-7,10,18H,8-9H2,1-2H3 |
| InChIKey | RACQRCWQKBRZMB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.66 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |