C16H16N2O — CID 62487138
1-(6-methyl-1,3-benzoxazol-2-yl)-1-phenylethanamine (PubChem CID 62487138) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 1-(6-methyl-1,3-benzoxazol-2-yl)-1-phenylethanamine.
| Compound Name | 1-(6-methyl-1,3-benzoxazol-2-yl)-1-phenylethanamine |
|---|---|
| PubChem CID | 62487138 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-(6-methyl-1,3-benzoxazol-2-yl)-1-phenylethanamine |
| SMILES | Cc1ccc2nc(C(C)(N)c3ccccc3)oc2c1 |
| InChI | InChI=1S/C16H16N2O/c1-11-8-9-13-14(10-11)19-15(18-13)16(2,17)12-6-4-3-5-7-12/h3-10H,17H2,1-2H3 |
| InChIKey | VHSSMHRAVLTSFP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |