C12H19NO2S — CID 62488456
methyl 2,3-dimethyl-2-(thiophen-2-ylmethylamino)butanoate (PubChem CID 62488456) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is methyl 2,3-dimethyl-2-(thiophen-2-ylmethylamino)butanoate.
| Compound Name | methyl 2,3-dimethyl-2-(thiophen-2-ylmethylamino)butanoate |
|---|---|
| PubChem CID | 62488456 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | methyl 2,3-dimethyl-2-(thiophen-2-ylmethylamino)butanoate |
| SMILES | COC(=O)C(C)(NCc1cccs1)C(C)C |
| InChI | InChI=1S/C12H19NO2S/c1-9(2)12(3,11(14)15-4)13-8-10-6-5-7-16-10/h5-7,9,13H,8H2,1-4H3 |
| InChIKey | AVPAJHZBPGEVCO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |