C11H18N2O3S — CID 66165551
3,3-dimethoxy-2-methyl-2-(thiophen-2-ylmethylamino)propanamide (PubChem CID 66165551) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 3,3-dimethoxy-2-methyl-2-(thiophen-2-ylmethylamino)propanamide.
| Compound Name | 3,3-dimethoxy-2-methyl-2-(thiophen-2-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 66165551 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3,3-dimethoxy-2-methyl-2-(thiophen-2-ylmethylamino)propanamide |
| SMILES | COC(OC)C(C)(NCc1cccs1)C(N)=O |
| InChI | InChI=1S/C11H18N2O3S/c1-11(9(12)14,10(15-2)16-3)13-7-8-5-4-6-17-8/h4-6,10,13H,7H2,1-3H3,(H2,12,14) |
| InChIKey | DTVZGHBNBVCMFD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|