About octan-2-yl 2-(3-aminophenyl)acetate
octan-2-yl 2-(3-aminophenyl)acetate (PubChem CID 62499041) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is octan-2-yl 2-(3-aminophenyl)acetate.
Molecular Properties
| Compound Name | octan-2-yl 2-(3-aminophenyl)acetate |
| PubChem CID | 62499041 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | octan-2-yl 2-(3-aminophenyl)acetate |
| SMILES | CCCCCCC(C)OC(=O)Cc1cccc(N)c1 |
| InChI | InChI=1S/C16H25NO2/c1-3-4-5-6-8-13(2)19-16(18)12-14-9-7-10-15(17)11-14/h7,9-11,13H,3-6,8,12,17H2,1-2H3 |
| InChIKey | GAFAPSNVTBFEGK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze octan-2-yl 2-(3-aminophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-2-yl 2-(3-aminophenyl)acetate?
The IUPAC name of octan-2-yl 2-(3-aminophenyl)acetate (CID 62499041) is octan-2-yl 2-(3-aminophenyl)acetate.
What is the SMILES notation for octan-2-yl 2-(3-aminophenyl)acetate?
The canonical SMILES for octan-2-yl 2-(3-aminophenyl)acetate is CCCCCCC(C)OC(=O)Cc1cccc(N)c1.
What is the InChIKey of octan-2-yl 2-(3-aminophenyl)acetate?
The InChIKey is GAFAPSNVTBFEGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-3-4-5-6-8-13(2)19-16(18)12-14-9-7-10-15(17)11-14/h7,9-11,13H,3-6,8,12,17H2,1-2H3.
What are the key properties of octan-2-yl 2-(3-aminophenyl)acetate?
octan-2-yl 2-(3-aminophenyl)acetate has a molecular weight of 263.38 g/mol, XLogP of 3.71, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octan-2-yl 2-(3-aminophenyl)acetate is sourced from PubChem (CID 62499041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).