C29H40O10 — CID 6250124
(18Z,20Z)-12-hydroxy-17-(1-hydroxyethyl)-5-(hydroxymethyl)-13,25-dimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,18,20-triene-26,2'-oxirane]-11,22-dione (PubChem CID 6250124) has the molecular formula C29H40O10 and a molecular weight of 548.63 g/mol. Its IUPAC name is (18Z,20Z)-12-hydroxy-17-(1-hydroxyethyl)-5-(hydroxymethyl)-13,25-dimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,18,20-triene-26,2'-oxirane]-11,22-dione.
| Compound Name | (18Z,20Z)-12-hydroxy-17-(1-hydroxyethyl)-5-(hydroxymethyl)-13,25-dimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,18,20-triene-26,2'-oxirane]-11,22-dione |
|---|---|
| PubChem CID | 6250124 |
| Molecular Formula | C29H40O10 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | (18Z,20Z)-12-hydroxy-17-(1-hydroxyethyl)-5-(hydroxymethyl)-13,25-dimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,18,20-triene-26,2'-oxirane]-11,22-dione |
| SMILES | CC(O)C1/C=C\C=C/C(=O)OC2CC3OC4C=C(CO)CCC4(COC(=O)C(O)C(C)CCO1)C2(C)C31CO1 |
| InChI | InChI=1S/C29H40O10/c1-17-9-11-35-20(18(2)31)6-4-5-7-24(32)39-21-13-23-29(16-37-29)27(21,3)28(15-36-26(34)25(17)33)10-8-19(14-30)12-22(28)38-23/h4-7,12,17-18,20-23,25,30-31,33H,8-11,13-16H2,1-3H3/b6-4-,7-5- |
| InChIKey | MTCJPNLHWBJVAG-PEPZGXQESA-N |
| XLogP | 1.37 |
| TPSA | 144.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|