C14H16ClNO3 — CID 62505452
2-[1-[2-(3-chlorophenyl)acetyl]pyrrolidin-2-yl]acetic acid (PubChem CID 62505452) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-[1-[2-(3-chlorophenyl)acetyl]pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[1-[2-(3-chlorophenyl)acetyl]pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 62505452 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-[1-[2-(3-chlorophenyl)acetyl]pyrrolidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN1C(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H16ClNO3/c15-11-4-1-3-10(7-11)8-13(17)16-6-2-5-12(16)9-14(18)19/h1,3-4,7,12H,2,5-6,8-9H2,(H,18,19) |
| InChIKey | GIFHRECLOLOIAY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |