C14H24N4O — CID 62506285
2-cyclohexyl-4-(oxan-4-yl)imidazole-1,5-diamine (PubChem CID 62506285) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-cyclohexyl-4-(oxan-4-yl)imidazole-1,5-diamine.
| Compound Name | 2-cyclohexyl-4-(oxan-4-yl)imidazole-1,5-diamine |
|---|---|
| PubChem CID | 62506285 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 2-cyclohexyl-4-(oxan-4-yl)imidazole-1,5-diamine |
| SMILES | Nc1c(C2CCOCC2)nc(C2CCCCC2)n1N |
| InChI | InChI=1S/C14H24N4O/c15-13-12(10-6-8-19-9-7-10)17-14(18(13)16)11-4-2-1-3-5-11/h10-11H,1-9,15-16H2 |
| InChIKey | NEDHORBYWMDSTJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |