C17H28N4 — CID 62508066
1-[1-(dimethylamino)-3-methylbutan-2-yl]-2-propylbenzimidazol-5-amine (PubChem CID 62508066) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is 1-[1-(dimethylamino)-3-methylbutan-2-yl]-2-propylbenzimidazol-5-amine.
| Compound Name | 1-[1-(dimethylamino)-3-methylbutan-2-yl]-2-propylbenzimidazol-5-amine |
|---|---|
| PubChem CID | 62508066 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 1-[1-(dimethylamino)-3-methylbutan-2-yl]-2-propylbenzimidazol-5-amine |
| SMILES | CCCc1nc2cc(N)ccc2n1C(CN(C)C)C(C)C |
| InChI | InChI=1S/C17H28N4/c1-6-7-17-19-14-10-13(18)8-9-15(14)21(17)16(12(2)3)11-20(4)5/h8-10,12,16H,6-7,11,18H2,1-5H3 |
| InChIKey | UCZQGLCZUNQKFV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|