C15H21ClIN3 — CID 66081448
2-[2-(chloromethyl)-5-iodobenzimidazol-1-yl]-N,N,3-trimethylbutan-1-amine (PubChem CID 66081448) has the molecular formula C15H21ClIN3 and a molecular weight of 405.71 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-5-iodobenzimidazol-1-yl]-N,N,3-trimethylbutan-1-amine.
| Compound Name | 2-[2-(chloromethyl)-5-iodobenzimidazol-1-yl]-N,N,3-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 66081448 |
| Molecular Formula | C15H21ClIN3 |
| Molecular Weight | 405.71 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 2-[2-(chloromethyl)-5-iodobenzimidazol-1-yl]-N,N,3-trimethylbutan-1-amine |
| SMILES | CC(C)C(CN(C)C)n1c(CCl)nc2cc(I)ccc21 |
| InChI | InChI=1S/C15H21ClIN3/c1-10(2)14(9-19(3)4)20-13-6-5-11(17)7-12(13)18-15(20)8-16/h5-7,10,14H,8-9H2,1-4H3 |
| InChIKey | MLWLSMDAQFORRO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.71 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|