C15H21N3 — CID 62508321
1-(2,3-dimethylcyclohexyl)benzimidazol-5-amine (PubChem CID 62508321) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-(2,3-dimethylcyclohexyl)benzimidazol-5-amine.
| Compound Name | 1-(2,3-dimethylcyclohexyl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 62508321 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 1-(2,3-dimethylcyclohexyl)benzimidazol-5-amine |
| SMILES | CC1CCCC(n2cnc3cc(N)ccc32)C1C |
| InChI | InChI=1S/C15H21N3/c1-10-4-3-5-14(11(10)2)18-9-17-13-8-12(16)6-7-15(13)18/h6-11,14H,3-5,16H2,1-2H3 |
| InChIKey | YLCGJZFBEGWSLX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|