About 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine
1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine (PubChem CID 62508411) has the molecular formula C14H17N5O
and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine.
Molecular Properties
| Compound Name | 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine |
| PubChem CID | 62508411 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine |
| SMILES | Cc1noc(Cn2c(C(C)C)nc3cc(N)ccc32)n1 |
| InChI | InChI=1S/C14H17N5O/c1-8(2)14-17-11-6-10(15)4-5-12(11)19(14)7-13-16-9(3)18-20-13/h4-6,8H,7,15H2,1-3H3 |
| InChIKey | GAHMHFHDOHELTE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine?
The IUPAC name of 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine (CID 62508411) is 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine.
What is the SMILES notation for 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine?
The canonical SMILES for 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine is Cc1noc(Cn2c(C(C)C)nc3cc(N)ccc32)n1.
What is the InChIKey of 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine?
The InChIKey is GAHMHFHDOHELTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O/c1-8(2)14-17-11-6-10(15)4-5-12(11)19(14)7-13-16-9(3)18-20-13/h4-6,8H,7,15H2,1-3H3.
What are the key properties of 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine?
1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine has a molecular weight of 271.32 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-propan-2-ylbenzimidazol-5-amine is sourced from PubChem (CID 62508411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).