C15H21BrF3NO — CID 62514231
2-[(2-bromophenyl)methyl]-N-methyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine (PubChem CID 62514231) has the molecular formula C15H21BrF3NO and a molecular weight of 368.24 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methyl]-N-methyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine.
| Compound Name | 2-[(2-bromophenyl)methyl]-N-methyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
|---|---|
| PubChem CID | 62514231 |
| Molecular Formula | C15H21BrF3NO |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 2-[(2-bromophenyl)methyl]-N-methyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
| SMILES | CNCC(CCCOCC(F)(F)F)Cc1ccccc1Br |
| InChI | InChI=1S/C15H21BrF3NO/c1-20-10-12(5-4-8-21-11-15(17,18)19)9-13-6-2-3-7-14(13)16/h2-3,6-7,12,20H,4-5,8-11H2,1H3 |
| InChIKey | VEIOGOGRLSYWKA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|