C14H19F4NO — CID 62515043
2-[(4-fluorophenyl)methyl]-N-methyl-4-(2,2,2-trifluoroethoxy)butan-1-amine (PubChem CID 62515043) has the molecular formula C14H19F4NO and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-N-methyl-4-(2,2,2-trifluoroethoxy)butan-1-amine.
| Compound Name | 2-[(4-fluorophenyl)methyl]-N-methyl-4-(2,2,2-trifluoroethoxy)butan-1-amine |
|---|---|
| PubChem CID | 62515043 |
| Molecular Formula | C14H19F4NO |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-N-methyl-4-(2,2,2-trifluoroethoxy)butan-1-amine |
| SMILES | CNCC(CCOCC(F)(F)F)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H19F4NO/c1-19-9-12(6-7-20-10-14(16,17)18)8-11-2-4-13(15)5-3-11/h2-5,12,19H,6-10H2,1H3 |
| InChIKey | KOTXAMKMOBJRIV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|