C13H17BrF3NO — CID 62530373
2-[(4-bromophenyl)methyl]-4-(2,2,2-trifluoroethoxy)butan-1-amine (PubChem CID 62530373) has the molecular formula C13H17BrF3NO and a molecular weight of 340.18 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-4-(2,2,2-trifluoroethoxy)butan-1-amine.
| Compound Name | 2-[(4-bromophenyl)methyl]-4-(2,2,2-trifluoroethoxy)butan-1-amine |
|---|---|
| PubChem CID | 62530373 |
| Molecular Formula | C13H17BrF3NO |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-4-(2,2,2-trifluoroethoxy)butan-1-amine |
| SMILES | NCC(CCOCC(F)(F)F)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H17BrF3NO/c14-12-3-1-10(2-4-12)7-11(8-18)5-6-19-9-13(15,16)17/h1-4,11H,5-9,18H2 |
| InChIKey | AQPKETUXUIGGHI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|