C16H26FNO2S — CID 62514698
2-[(4-fluorophenyl)methyl]-N-(2-methylpropyl)-4-methylsulfonylbutan-1-amine (PubChem CID 62514698) has the molecular formula C16H26FNO2S and a molecular weight of 315.45 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-N-(2-methylpropyl)-4-methylsulfonylbutan-1-amine.
| Compound Name | 2-[(4-fluorophenyl)methyl]-N-(2-methylpropyl)-4-methylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 62514698 |
| Molecular Formula | C16H26FNO2S |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-N-(2-methylpropyl)-4-methylsulfonylbutan-1-amine |
| SMILES | CC(C)CNCC(CCS(C)(=O)=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H26FNO2S/c1-13(2)11-18-12-15(8-9-21(3,19)20)10-14-4-6-16(17)7-5-14/h4-7,13,15,18H,8-12H2,1-3H3 |
| InChIKey | CRFRTUWRCIZJOG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |