C14H26N2O3 — CID 62519781
N-[3-[3-(hydroxymethyl)pentan-3-ylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 62519781) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is N-[3-[3-(hydroxymethyl)pentan-3-ylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-[3-[3-(hydroxymethyl)pentan-3-ylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 62519781 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N-[3-[3-(hydroxymethyl)pentan-3-ylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | CCC(CC)(CO)NC(=O)CCNC(=O)C1CC1C |
| InChI | InChI=1S/C14H26N2O3/c1-4-14(5-2,9-17)16-12(18)6-7-15-13(19)11-8-10(11)3/h10-11,17H,4-9H2,1-3H3,(H,15,19)(H,16,18) |
| InChIKey | FPXCIUILKBRECS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |