C17H18N2O2 — CID 62524941
3-(1H-indol-3-yl)-N-[(5-methylfuran-2-yl)methyl]propanamide (PubChem CID 62524941) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-N-[(5-methylfuran-2-yl)methyl]propanamide.
| Compound Name | 3-(1H-indol-3-yl)-N-[(5-methylfuran-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 62524941 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-(1H-indol-3-yl)-N-[(5-methylfuran-2-yl)methyl]propanamide |
| SMILES | Cc1ccc(CNC(=O)CCc2c[nH]c3ccccc23)o1 |
| InChI | InChI=1S/C17H18N2O2/c1-12-6-8-14(21-12)11-19-17(20)9-7-13-10-18-16-5-3-2-4-15(13)16/h2-6,8,10,18H,7,9,11H2,1H3,(H,19,20) |
| InChIKey | UTIIPAGZGHLZLW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |