C13H18N2O3S — CID 62525158
5-acetamido-N-[1-(hydroxymethyl)cyclopentyl]thiophene-2-carboxamide (PubChem CID 62525158) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is 5-acetamido-N-[1-(hydroxymethyl)cyclopentyl]thiophene-2-carboxamide.
| Compound Name | 5-acetamido-N-[1-(hydroxymethyl)cyclopentyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 62525158 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 5-acetamido-N-[1-(hydroxymethyl)cyclopentyl]thiophene-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(C(=O)NC2(CO)CCCC2)s1 |
| InChI | InChI=1S/C13H18N2O3S/c1-9(17)14-11-5-4-10(19-11)12(18)15-13(8-16)6-2-3-7-13/h4-5,16H,2-3,6-8H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | PQDCQQPLFGSTHC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |