C15H22FNO3S — CID 62525307
2-fluoro-N-[1-(hydroxymethyl)-4-methylcyclohexyl]-5-methylbenzenesulfonamide (PubChem CID 62525307) has the molecular formula C15H22FNO3S and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-fluoro-N-[1-(hydroxymethyl)-4-methylcyclohexyl]-5-methylbenzenesulfonamide.
| Compound Name | 2-fluoro-N-[1-(hydroxymethyl)-4-methylcyclohexyl]-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 62525307 |
| Molecular Formula | C15H22FNO3S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-fluoro-N-[1-(hydroxymethyl)-4-methylcyclohexyl]-5-methylbenzenesulfonamide |
| SMILES | Cc1ccc(F)c(S(=O)(=O)NC2(CO)CCC(C)CC2)c1 |
| InChI | InChI=1S/C15H22FNO3S/c1-11-5-7-15(10-18,8-6-11)17-21(19,20)14-9-12(2)3-4-13(14)16/h3-4,9,11,17-18H,5-8,10H2,1-2H3 |
| InChIKey | DKBRXOXTBZZKEA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |