C14H19N3OS — CID 62525512
[3-methyl-1-(thieno[3,2-d]pyrimidin-4-ylamino)cyclohexyl]methanol (PubChem CID 62525512) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is [3-methyl-1-(thieno[3,2-d]pyrimidin-4-ylamino)cyclohexyl]methanol.
| Compound Name | [3-methyl-1-(thieno[3,2-d]pyrimidin-4-ylamino)cyclohexyl]methanol |
|---|---|
| PubChem CID | 62525512 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | [3-methyl-1-(thieno[3,2-d]pyrimidin-4-ylamino)cyclohexyl]methanol |
| SMILES | CC1CCCC(CO)(Nc2ncnc3ccsc23)C1 |
| InChI | InChI=1S/C14H19N3OS/c1-10-3-2-5-14(7-10,8-18)17-13-12-11(4-6-19-12)15-9-16-13/h4,6,9-10,18H,2-3,5,7-8H2,1H3,(H,15,16,17) |
| InChIKey | NIKGJBBCUBPVQH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |