C15H22N2O3 — CID 62526363
methyl 2-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]pyridine-3-carboxylate (PubChem CID 62526363) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl 2-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]pyridine-3-carboxylate.
| Compound Name | methyl 2-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 62526363 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | methyl 2-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1NC1(CO)CCCC(C)C1 |
| InChI | InChI=1S/C15H22N2O3/c1-11-5-3-7-15(9-11,10-18)17-13-12(14(19)20-2)6-4-8-16-13/h4,6,8,11,18H,3,5,7,9-10H2,1-2H3,(H,16,17) |
| InChIKey | PBGIFUPQEPICIA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |