C14H20N2O4 — CID 62525984
2-hydroxy-N-[1-(hydroxymethyl)-3-methylcyclohexyl]-6-oxo-1H-pyridine-4-carboxamide (PubChem CID 62525984) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-hydroxy-N-[1-(hydroxymethyl)-3-methylcyclohexyl]-6-oxo-1H-pyridine-4-carboxamide.
| Compound Name | 2-hydroxy-N-[1-(hydroxymethyl)-3-methylcyclohexyl]-6-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62525984 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-hydroxy-N-[1-(hydroxymethyl)-3-methylcyclohexyl]-6-oxo-1H-pyridine-4-carboxamide |
| SMILES | CC1CCCC(CO)(NC(=O)c2cc(O)[nH]c(=O)c2)C1 |
| InChI | InChI=1S/C14H20N2O4/c1-9-3-2-4-14(7-9,8-17)16-13(20)10-5-11(18)15-12(19)6-10/h5-6,9,17H,2-4,7-8H2,1H3,(H,16,20)(H2,15,18,19) |
| InChIKey | QXJQBHFMYIBTAL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |