C16H25NO2S — CID 62528051
4-ethyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]-5-methylthiophene-2-carboxamide (PubChem CID 62528051) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is 4-ethyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]-5-methylthiophene-2-carboxamide.
| Compound Name | 4-ethyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 62528051 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 4-ethyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]-5-methylthiophene-2-carboxamide |
| SMILES | CCc1cc(C(=O)NC2(CO)CCC(C)CC2)sc1C |
| InChI | InChI=1S/C16H25NO2S/c1-4-13-9-14(20-12(13)3)15(19)17-16(10-18)7-5-11(2)6-8-16/h9,11,18H,4-8,10H2,1-3H3,(H,17,19) |
| InChIKey | SUOCADSPUNSVDQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |