C14H9F2N3O2 — CID 62531435
4-[(2,3-difluoro-6-nitroanilino)methyl]benzonitrile (PubChem CID 62531435) has the molecular formula C14H9F2N3O2 and a molecular weight of 289.24 g/mol. Its IUPAC name is 4-[(2,3-difluoro-6-nitroanilino)methyl]benzonitrile.
| Compound Name | 4-[(2,3-difluoro-6-nitroanilino)methyl]benzonitrile |
|---|---|
| PubChem CID | 62531435 |
| Molecular Formula | C14H9F2N3O2 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 4-[(2,3-difluoro-6-nitroanilino)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNc2c([N+](=O)[O-])ccc(F)c2F)cc1 |
| InChI | InChI=1S/C14H9F2N3O2/c15-11-5-6-12(19(20)21)14(13(11)16)18-8-10-3-1-9(7-17)2-4-10/h1-6,18H,8H2 |
| InChIKey | WGXJZQLVIQUAMW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|