C13H9BrF2N2O2 — CID 62534010
N-[(3-bromophenyl)methyl]-2,3-difluoro-6-nitroaniline (PubChem CID 62534010) has the molecular formula C13H9BrF2N2O2 and a molecular weight of 343.13 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2,3-difluoro-6-nitroaniline.
| Compound Name | N-[(3-bromophenyl)methyl]-2,3-difluoro-6-nitroaniline |
|---|---|
| PubChem CID | 62534010 |
| Molecular Formula | C13H9BrF2N2O2 |
| Molecular Weight | 343.13 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2,3-difluoro-6-nitroaniline |
| SMILES | O=[N+]([O-])c1ccc(F)c(F)c1NCc1cccc(Br)c1 |
| InChI | InChI=1S/C13H9BrF2N2O2/c14-9-3-1-2-8(6-9)7-17-13-11(18(19)20)5-4-10(15)12(13)16/h1-6,17H,7H2 |
| InChIKey | FFPXFXCOEUIVCW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.13 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|