C13H8F2N2O — CID 62533416
2-(6-amino-2,3-difluorophenoxy)benzonitrile (PubChem CID 62533416) has the molecular formula C13H8F2N2O and a molecular weight of 246.22 g/mol. Its IUPAC name is 2-(6-amino-2,3-difluorophenoxy)benzonitrile.
| Compound Name | 2-(6-amino-2,3-difluorophenoxy)benzonitrile |
|---|---|
| PubChem CID | 62533416 |
| Molecular Formula | C13H8F2N2O |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-(6-amino-2,3-difluorophenoxy)benzonitrile |
| SMILES | N#Cc1ccccc1Oc1c(N)ccc(F)c1F |
| InChI | InChI=1S/C13H8F2N2O/c14-9-5-6-10(17)13(12(9)15)18-11-4-2-1-3-8(11)7-16/h1-6H,17H2 |
| InChIKey | LUYRENVKADJIHE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|