C13H11ClFN3S — CID 62538283
2-[(3-chloro-4-fluorophenyl)methylamino]pyridine-4-carbothioamide (PubChem CID 62538283) has the molecular formula C13H11ClFN3S and a molecular weight of 295.77 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methylamino]pyridine-4-carbothioamide.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methylamino]pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 62538283 |
| Molecular Formula | C13H11ClFN3S |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methylamino]pyridine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(NCc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C13H11ClFN3S/c14-10-5-8(1-2-11(10)15)7-18-12-6-9(13(16)19)3-4-17-12/h1-6H,7H2,(H2,16,19)(H,17,18) |
| InChIKey | WBPILKIPFBUNRW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|