C12H10ClFN4S — CID 62683624
3-[(3-chloro-4-fluorophenyl)methylamino]pyrazine-2-carbothioamide (PubChem CID 62683624) has the molecular formula C12H10ClFN4S and a molecular weight of 296.76 g/mol. Its IUPAC name is 3-[(3-chloro-4-fluorophenyl)methylamino]pyrazine-2-carbothioamide.
| Compound Name | 3-[(3-chloro-4-fluorophenyl)methylamino]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 62683624 |
| Molecular Formula | C12H10ClFN4S |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 3-[(3-chloro-4-fluorophenyl)methylamino]pyrazine-2-carbothioamide |
| SMILES | NC(=S)c1nccnc1NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H10ClFN4S/c13-8-5-7(1-2-9(8)14)6-18-12-10(11(15)19)16-3-4-17-12/h1-5H,6H2,(H2,15,19)(H,17,18) |
| InChIKey | FARYDWHBYDCORV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|