C15H21NO3 — CID 62538862
ethyl 2-[[2-(2,5-dimethylphenyl)acetyl]amino]propanoate (PubChem CID 62538862) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is ethyl 2-[[2-(2,5-dimethylphenyl)acetyl]amino]propanoate.
| Compound Name | ethyl 2-[[2-(2,5-dimethylphenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 62538862 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | ethyl 2-[[2-(2,5-dimethylphenyl)acetyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C15H21NO3/c1-5-19-15(18)12(4)16-14(17)9-13-8-10(2)6-7-11(13)3/h6-8,12H,5,9H2,1-4H3,(H,16,17) |
| InChIKey | QOKQEANOWHIRTE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |